C18H21NO — CID 11054650
(E)-2-phenyl-N-[(1R)-1-phenylbutoxy]ethanimine (PubChem CID 11054650) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (E)-2-phenyl-N-[(1R)-1-phenylbutoxy]ethanimine.
| Compound Name | (E)-2-phenyl-N-[(1R)-1-phenylbutoxy]ethanimine |
|---|---|
| PubChem CID | 11054650 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (E)-2-phenyl-N-[(1R)-1-phenylbutoxy]ethanimine |
| SMILES | CCC[C@@H](O/N=C/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO/c1-2-9-18(17-12-7-4-8-13-17)20-19-15-14-16-10-5-3-6-11-16/h3-8,10-13,15,18H,2,9,14H2,1H3/b19-15+/t18-/m1/s1 |
| InChIKey | HIOSQBVAUIWWAN-AQRXXJNJSA-N |
| XLogP | 4.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|