C28H39NO11 — CID 73324463
[3,4,5-triacetyloxy-6-[(2,4-dimethyl-3-phenylmethoxypentylidene)amino]oxyoxan-2-yl]methyl acetate (PubChem CID 73324463) has the molecular formula C28H39NO11 and a molecular weight of 565.62 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[(2,4-dimethyl-3-phenylmethoxypentylidene)amino]oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[(2,4-dimethyl-3-phenylmethoxypentylidene)amino]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 73324463 |
| Molecular Formula | C28H39NO11 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[(2,4-dimethyl-3-phenylmethoxypentylidene)amino]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(ON=CC(C)C(OCc2ccccc2)C(C)C)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C28H39NO11/c1-16(2)24(35-14-22-11-9-8-10-12-22)17(3)13-29-40-28-27(38-21(7)33)26(37-20(6)32)25(36-19(5)31)23(39-28)15-34-18(4)30/h8-13,16-17,23-28H,14-15H2,1-7H3 |
| InChIKey | XYFCESQDYQMDNU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|