C22H34N2O4 — CID 11165220
(E,4S,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-imine (PubChem CID 11165220) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is (E,4S,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-imine.
| Compound Name | (E,4S,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
|---|---|
| PubChem CID | 11165220 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | (E,4S,6R)-N-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]-2,2,4,6-tetramethyl-4-(phenylmethoxymethyl)-1,3-dioxan-5-imine |
| SMILES | COC[C@H]1CCCN1/N=C1\[C@@H](C)OC(C)(C)O[C@]1(C)COCc1ccccc1 |
| InChI | InChI=1S/C22H34N2O4/c1-17-20(23-24-13-9-12-19(24)15-25-5)22(4,28-21(2,3)27-17)16-26-14-18-10-7-6-8-11-18/h6-8,10-11,17,19H,9,12-16H2,1-5H3/b23-20+/t17-,19-,22-/m1/s1 |
| InChIKey | ATJMVKCVGLVJOZ-QYORSUQISA-N |
| XLogP | 3.60 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|