C16H15NOS — CID 177391470
(E,E)-N-phenylmethoxy-3-phenylsulfanylprop-2-en-1-imine (PubChem CID 177391470) has the molecular formula C16H15NOS and a molecular weight of 269.37 g/mol. Its IUPAC name is (E,E)-N-phenylmethoxy-3-phenylsulfanylprop-2-en-1-imine.
| Compound Name | (E,E)-N-phenylmethoxy-3-phenylsulfanylprop-2-en-1-imine |
|---|---|
| PubChem CID | 177391470 |
| Molecular Formula | C16H15NOS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (E,E)-N-phenylmethoxy-3-phenylsulfanylprop-2-en-1-imine |
| SMILES | C(=C/Sc1ccccc1)\C=N\OCc1ccccc1 |
| InChI | InChI=1S/C16H15NOS/c1-3-8-15(9-4-1)14-18-17-12-7-13-19-16-10-5-2-6-11-16/h1-13H,14H2/b13-7+,17-12+ |
| InChIKey | APJUFYASNOVUCB-MUZUHFIMSA-N |
| XLogP | 4.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|