C20H21NO2 — CID 177391558
(4S)-2-(3,3-diphenyloxiran-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 177391558) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is (4S)-2-(3,3-diphenyloxiran-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-(3,3-diphenyloxiran-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 177391558 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (4S)-2-(3,3-diphenyloxiran-2-yl)-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@H]1COC(C2OC2(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C20H21NO2/c1-14(2)17-13-22-19(21-17)18-20(23-18,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17-18H,13H2,1-2H3/t17-,18?/m1/s1 |
| InChIKey | XLHULWGLELEYFU-QNSVNVJESA-N |
| XLogP | 3.78 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|