C27H33NO3 — CID 177395567
methyl 5-[4-(3-methyl-4-phenylmethoxyphenyl)heptan-4-yl]-1H-pyrrole-2-carboxylate (PubChem CID 177395567) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is methyl 5-[4-(3-methyl-4-phenylmethoxyphenyl)heptan-4-yl]-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 5-[4-(3-methyl-4-phenylmethoxyphenyl)heptan-4-yl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 177395567 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | methyl 5-[4-(3-methyl-4-phenylmethoxyphenyl)heptan-4-yl]-1H-pyrrole-2-carboxylate |
| SMILES | CCCC(CCC)(c1ccc(OCc2ccccc2)c(C)c1)c1ccc(C(=O)OC)[nH]1 |
| InChI | InChI=1S/C27H33NO3/c1-5-16-27(17-6-2,25-15-13-23(28-25)26(29)30-4)22-12-14-24(20(3)18-22)31-19-21-10-8-7-9-11-21/h7-15,18,28H,5-6,16-17,19H2,1-4H3 |
| InChIKey | FYYRZOIFITVURX-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |