C28H31NO5 — CID 59166710
methyl 4-[[2-ethyl-2-(3-methyl-4-phenylmethoxyphenyl)butanoyl]amino]-3-hydroxybenzoate (PubChem CID 59166710) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 4-[[2-ethyl-2-(3-methyl-4-phenylmethoxyphenyl)butanoyl]amino]-3-hydroxybenzoate.
| Compound Name | methyl 4-[[2-ethyl-2-(3-methyl-4-phenylmethoxyphenyl)butanoyl]amino]-3-hydroxybenzoate |
|---|---|
| PubChem CID | 59166710 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl 4-[[2-ethyl-2-(3-methyl-4-phenylmethoxyphenyl)butanoyl]amino]-3-hydroxybenzoate |
| SMILES | CCC(CC)(C(=O)Nc1ccc(C(=O)OC)cc1O)c1ccc(OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H31NO5/c1-5-28(6-2,27(32)29-23-14-12-21(17-24(23)30)26(31)33-4)22-13-15-25(19(3)16-22)34-18-20-10-8-7-9-11-20/h7-17,30H,5-6,18H2,1-4H3,(H,29,32) |
| InChIKey | DHBLVCMSCPGVSM-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|