C28H31NO5 — CID 91234373
methyl 3-[butanoyl-[1-(3-methyl-4-phenylmethoxyphenyl)ethyl]amino]-4-hydroxybenzoate (PubChem CID 91234373) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 3-[butanoyl-[1-(3-methyl-4-phenylmethoxyphenyl)ethyl]amino]-4-hydroxybenzoate.
| Compound Name | methyl 3-[butanoyl-[1-(3-methyl-4-phenylmethoxyphenyl)ethyl]amino]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 91234373 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | methyl 3-[butanoyl-[1-(3-methyl-4-phenylmethoxyphenyl)ethyl]amino]-4-hydroxybenzoate |
| SMILES | CCCC(=O)N(c1cc(C(=O)OC)ccc1O)C(C)c1ccc(OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C28H31NO5/c1-5-9-27(31)29(24-17-23(28(32)33-4)12-14-25(24)30)20(3)22-13-15-26(19(2)16-22)34-18-21-10-7-6-8-11-21/h6-8,10-17,20,30H,5,9,18H2,1-4H3 |
| InChIKey | CCMFQYMXPIJCRC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |