C58H90S2Sn2 — CID 177397936
tributyl-(4,5-dihexyl-1,8-diphenyl-2-tributylstannylthieno[3,2-e][1]benzothiol-7-yl)stannane (PubChem CID 177397936) has the molecular formula C58H90S2Sn2 and a molecular weight of 1088.91 g/mol. Its IUPAC name is tributyl-(4,5-dihexyl-1,8-diphenyl-2-tributylstannylthieno[3,2-e][1]benzothiol-7-yl)stannane.
| Compound Name | tributyl-(4,5-dihexyl-1,8-diphenyl-2-tributylstannylthieno[3,2-e][1]benzothiol-7-yl)stannane |
|---|---|
| PubChem CID | 177397936 |
| Molecular Formula | C58H90S2Sn2 |
| Molecular Weight | 1088.91 g/mol |
| Exact Mass | 1090.45 |
| IUPAC Name | tributyl-(4,5-dihexyl-1,8-diphenyl-2-tributylstannylthieno[3,2-e][1]benzothiol-7-yl)stannane |
| SMILES | CCCCCCc1c(CCCCCC)c2sc([Sn](CCCC)(CCCC)CCCC)c(-c3ccccc3)c2c2c(-c3ccccc3)c([Sn](CCCC)(CCCC)CCCC)sc12 |
| InChI | InChI=1S/C34H36S2.6C4H9.2Sn/c1-3-5-7-15-21-27-28(22-16-8-6-4-2)34-32(30(24-36-34)26-19-13-10-14-20-26)31-29(23-35-33(27)31)25-17-11-9-12-18-25;6*1-3-4-2;;/h9-14,17-20H,3-8,15-16,21-22H2,1-2H3;6*1,3-4H2,2H3;; |
| InChIKey | FGSRATSROBRVLF-UHFFFAOYSA-N |
| XLogP | 19.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1088.91 |
| LogP ≤ 5 | 19.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|