C31H44FNO3Sn — CID 177398450
methyl (E,2R)-2-benzamido-2-benzyl-4-fluoro-4-tributylstannylbut-3-enoate (PubChem CID 177398450) has the molecular formula C31H44FNO3Sn and a molecular weight of 616.41 g/mol. Its IUPAC name is methyl (E,2R)-2-benzamido-2-benzyl-4-fluoro-4-tributylstannylbut-3-enoate.
| Compound Name | methyl (E,2R)-2-benzamido-2-benzyl-4-fluoro-4-tributylstannylbut-3-enoate |
|---|---|
| PubChem CID | 177398450 |
| Molecular Formula | C31H44FNO3Sn |
| Molecular Weight | 616.41 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | methyl (E,2R)-2-benzamido-2-benzyl-4-fluoro-4-tributylstannylbut-3-enoate |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(F)=C/[C@@](Cc1ccccc1)(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C19H17FNO3.3C4H9.Sn/c1-24-18(23)19(12-13-20,14-15-8-4-2-5-9-15)21-17(22)16-10-6-3-7-11-16;3*1-3-4-2;/h2-12H,14H2,1H3,(H,21,22);3*1,3-4H2,2H3;/t19-;;;;/m0..../s1 |
| InChIKey | HTRUAXGKBAFCSI-QMKYUQMLSA-N |
| XLogP | 7.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.41 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |