About CID 177400193
CID 177400193 (PubChem CID 177400193) has the molecular formula C18H12Cl2N3O2
and a molecular weight of 373.22 g/mol.
Molecular Properties
| Compound Name | CID 177400193 |
| PubChem CID | 177400193 |
| Molecular Formula | C18H12Cl2N3O2 |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(Cl)c1[N]N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H12Cl2N3O2/c19-13-11-16(20)18(17(12-13)23(24)25)21-22(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12H |
| InChIKey | INYJVSSHLMNIGU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 60.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 177400193 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177400193?
The IUPAC name of CID 177400193 (CID 177400193) is not available.
What is the SMILES notation for CID 177400193?
The canonical SMILES for CID 177400193 is O=[N+]([O-])c1cc(Cl)cc(Cl)c1[N]N(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 177400193?
The InChIKey is INYJVSSHLMNIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Cl2N3O2/c19-13-11-16(20)18(17(12-13)23(24)25)21-22(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12H.
What are the key properties of CID 177400193?
CID 177400193 has a molecular weight of 373.22 g/mol, XLogP of 5.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177400193 is sourced from PubChem (CID 177400193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).