C12H12O2 — CID 177402596
(3S)-3-prop-2-enyl-2,3-dihydrochromen-4-one (PubChem CID 177402596) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is (3S)-3-prop-2-enyl-2,3-dihydrochromen-4-one.
| Compound Name | (3S)-3-prop-2-enyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 177402596 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (3S)-3-prop-2-enyl-2,3-dihydrochromen-4-one |
| SMILES | C=CC[C@H]1COc2ccccc2C1=O |
| InChI | InChI=1S/C12H12O2/c1-2-5-9-8-14-11-7-4-3-6-10(11)12(9)13/h2-4,6-7,9H,1,5,8H2/t9-/m0/s1 |
| InChIKey | CONFDGKTIFQCNB-VIFPVBQESA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|