C13H14O3S — CID 135006550
S-ethyl 2-(4-oxo-2,3-dihydrochromen-3-yl)ethanethioate (PubChem CID 135006550) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is S-ethyl 2-(4-oxo-2,3-dihydrochromen-3-yl)ethanethioate.
| Compound Name | S-ethyl 2-(4-oxo-2,3-dihydrochromen-3-yl)ethanethioate |
|---|---|
| PubChem CID | 135006550 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | S-ethyl 2-(4-oxo-2,3-dihydrochromen-3-yl)ethanethioate |
| SMILES | CCSC(=O)CC1COc2ccccc2C1=O |
| InChI | InChI=1S/C13H14O3S/c1-2-17-12(14)7-9-8-16-11-6-4-3-5-10(11)13(9)15/h3-6,9H,2,7-8H2,1H3 |
| InChIKey | WODRIBHYOPMOPB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|