C18H27O5P — CID 132580177
3-(dibutoxyphosphorylmethyl)-2,3-dihydrochromen-4-one (PubChem CID 132580177) has the molecular formula C18H27O5P and a molecular weight of 354.38 g/mol. Its IUPAC name is 3-(dibutoxyphosphorylmethyl)-2,3-dihydrochromen-4-one.
| Compound Name | 3-(dibutoxyphosphorylmethyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 132580177 |
| Molecular Formula | C18H27O5P |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-(dibutoxyphosphorylmethyl)-2,3-dihydrochromen-4-one |
| SMILES | CCCCOP(=O)(CC1COc2ccccc2C1=O)OCCCC |
| InChI | InChI=1S/C18H27O5P/c1-3-5-11-22-24(20,23-12-6-4-2)14-15-13-21-17-10-8-7-9-16(17)18(15)19/h7-10,15H,3-6,11-14H2,1-2H3 |
| InChIKey | AJBNAMVRBLQFGY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|