C14H20O2 — CID 177403192
(2Z)-3-hydroxy-2-[(2E,7Z)-nona-2,7-dienylidene]cyclopentan-1-one (PubChem CID 177403192) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2Z)-3-hydroxy-2-[(2E,7Z)-nona-2,7-dienylidene]cyclopentan-1-one.
| Compound Name | (2Z)-3-hydroxy-2-[(2E,7Z)-nona-2,7-dienylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 177403192 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2Z)-3-hydroxy-2-[(2E,7Z)-nona-2,7-dienylidene]cyclopentan-1-one |
| SMILES | C/C=C\CCC/C=C/C=C1\C(=O)CCC1O |
| InChI | InChI=1S/C14H20O2/c1-2-3-4-5-6-7-8-9-12-13(15)10-11-14(12)16/h2-3,7-9,13,15H,4-6,10-11H2,1H3/b3-2-,8-7+,12-9- |
| InChIKey | GNHXUYVRQQQIHR-XJAJUMTESA-N |
| XLogP | 2.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|