C24H40O4 — CID 162905253
trans-(2S,4S)-4-hydroxy-2-[(E)-octadec-9-enoyl]cyclohexane-1,3-dione (PubChem CID 162905253) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is trans-(2S,4S)-4-hydroxy-2-[(E)-octadec-9-enoyl]cyclohexane-1,3-dione.
| Compound Name | trans-(2S,4S)-4-hydroxy-2-[(E)-octadec-9-enoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 162905253 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | trans-(2S,4S)-4-hydroxy-2-[(E)-octadec-9-enoyl]cyclohexane-1,3-dione |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)[C@H]1C(=O)CC[C@H](O)C1=O |
| InChI | InChI=1S/C24H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(25)23-21(26)18-19-22(27)24(23)28/h9-10,22-23,27H,2-8,11-19H2,1H3/b10-9+/t22-,23-/m0/s1 |
| InChIKey | DIZDLUFZVXBGIT-XSOUEMDHSA-N |
| XLogP | 5.50 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|