C25H38O3 — CID 25158961
5-methyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione (PubChem CID 25158961) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 5-methyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione.
| Compound Name | 5-methyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 25158961 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | 5-methyl-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]cyclohexane-1,3-dione |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C1C(=O)CC(C)CC1=O |
| InChI | InChI=1S/C25H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(26)25-23(27)19-21(2)20-24(25)28/h4-5,7-8,10-11,21,25H,3,6,9,12-20H2,1-2H3/b5-4-,8-7-,11-10- |
| InChIKey | KTARHXWNMZWAJO-YSTUJMKBSA-N |
| XLogP | 6.33 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|