C14H24N2O4 — CID 177404610
dimethyl (2Z,5Z)-2,5-bis(dimethylaminomethylidene)hexanedioate (PubChem CID 177404610) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is dimethyl (2Z,5Z)-2,5-bis(dimethylaminomethylidene)hexanedioate.
| Compound Name | dimethyl (2Z,5Z)-2,5-bis(dimethylaminomethylidene)hexanedioate |
|---|---|
| PubChem CID | 177404610 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | dimethyl (2Z,5Z)-2,5-bis(dimethylaminomethylidene)hexanedioate |
| SMILES | COC(=O)/C(=C\N(C)C)CC/C(=C/N(C)C)C(=O)OC |
| InChI | InChI=1S/C14H24N2O4/c1-15(2)9-11(13(17)19-5)7-8-12(10-16(3)4)14(18)20-6/h9-10H,7-8H2,1-6H3/b11-9-,12-10- |
| InChIKey | LMNGRSXVEDQNHF-HWAYABPNSA-N |
| XLogP | 1.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|