C14H21NO5 — CID 135072895
dimethyl (2E,3E)-2-(dimethylaminomethylidene)-3-(2-oxopentylidene)butanedioate (PubChem CID 135072895) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is dimethyl (2E,3E)-2-(dimethylaminomethylidene)-3-(2-oxopentylidene)butanedioate.
| Compound Name | dimethyl (2E,3E)-2-(dimethylaminomethylidene)-3-(2-oxopentylidene)butanedioate |
|---|---|
| PubChem CID | 135072895 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | dimethyl (2E,3E)-2-(dimethylaminomethylidene)-3-(2-oxopentylidene)butanedioate |
| SMILES | CCCC(=O)/C=C(C(=O)OC)\C(=C/N(C)C)C(=O)OC |
| InChI | InChI=1S/C14H21NO5/c1-6-7-10(16)8-11(13(17)19-4)12(9-15(2)3)14(18)20-5/h8-9H,6-7H2,1-5H3/b11-8+,12-9+ |
| InChIKey | CRUFDACEQQONJN-HZOWPXDZSA-N |
| XLogP | 1.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|