About methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate
methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate (PubChem CID 168980029) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate.
Molecular Properties
| Compound Name | methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate |
| PubChem CID | 168980029 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate |
| SMILES | COC(=O)C(=O)/C(=C\N(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C11H17NO4/c1-7(2)9(13)8(6-12(3)4)10(14)11(15)16-5/h6-7H,1-5H3/b8-6- |
| InChIKey | BAOVRINOUUGUSP-VURMDHGXSA-N |
| XLogP | 0.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate?
The IUPAC name of methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate (CID 168980029) is methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate.
What is the SMILES notation for methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate?
The canonical SMILES for methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate is COC(=O)C(=O)/C(=C\N(C)C)C(=O)C(C)C.
What is the InChIKey of methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate?
The InChIKey is BAOVRINOUUGUSP-VURMDHGXSA-N. The full InChI is InChI=1S/C11H17NO4/c1-7(2)9(13)8(6-12(3)4)10(14)11(15)16-5/h6-7H,1-5H3/b8-6-.
What are the key properties of methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate?
methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate has a molecular weight of 227.26 g/mol, XLogP of 0.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-3-(dimethylaminomethylidene)-5-methyl-2,4-dioxohexanoate is sourced from PubChem (CID 168980029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).