C18H22ClNO3 — CID 177404821
ethyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 177404821) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is ethyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | ethyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 177404821 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | ethyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1/C=C/CCCN(Cc2ccccc2)C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C18H22ClNO3/c1-2-23-18(22)15-11-7-4-8-12-20(17(21)16(15)19)13-14-9-5-3-6-10-14/h3,5-7,9-11,15-16H,2,4,8,12-13H2,1H3/b11-7+/t15-,16-/m1/s1 |
| InChIKey | JBUANIGDZTWLON-KNFPLBEISA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|