C22H41NO5 — CID 177409827
4-[2-hydroxyethyl-bis[(E)-2-hydroxyoct-6-enyl]azaniumyl]butanoate (PubChem CID 177409827) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is 4-[2-hydroxyethyl-bis[(E)-2-hydroxyoct-6-enyl]azaniumyl]butanoate.
| Compound Name | 4-[2-hydroxyethyl-bis[(E)-2-hydroxyoct-6-enyl]azaniumyl]butanoate |
|---|---|
| PubChem CID | 177409827 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 4-[2-hydroxyethyl-bis[(E)-2-hydroxyoct-6-enyl]azaniumyl]butanoate |
| SMILES | C/C=C/CCCC(O)C[N+](CCO)(CCCC(=O)[O-])CC(O)CCC/C=C/C |
| InChI | InChI=1S/C22H41NO5/c1-3-5-7-9-12-20(25)18-23(16-17-24,15-11-14-22(27)28)19-21(26)13-10-8-6-4-2/h3-6,20-21,24-26H,7-19H2,1-2H3/b5-3+,6-4+ |
| InChIKey | YGZBQVMEEMZUIU-GGWOSOGESA-N |
| XLogP | 1.54 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|