C20H22N2O4 — CID 177410593
methyl (2R,3R,9R,10R,13R)-10-hydroxy-11-oxa-6,15-diazahexacyclo[12.7.0.02,6.03,10.09,13.016,21]henicosa-1(14),16,18,20-tetraene-13-carboxylate (PubChem CID 177410593) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is methyl (2R,3R,9R,10R,13R)-10-hydroxy-11-oxa-6,15-diazahexacyclo[12.7.0.02,6.03,10.09,13.016,21]henicosa-1(14),16,18,20-tetraene-13-carboxylate.
| Compound Name | methyl (2R,3R,9R,10R,13R)-10-hydroxy-11-oxa-6,15-diazahexacyclo[12.7.0.02,6.03,10.09,13.016,21]henicosa-1(14),16,18,20-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 177410593 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl (2R,3R,9R,10R,13R)-10-hydroxy-11-oxa-6,15-diazahexacyclo[12.7.0.02,6.03,10.09,13.016,21]henicosa-1(14),16,18,20-tetraene-13-carboxylate |
| SMILES | COC(=O)[C@]12CO[C@@]3(O)[C@@H]4CCN(CC[C@@H]31)[C@H]4c1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C20H22N2O4/c1-25-18(23)19-10-26-20(24)12-6-8-22(9-7-14(19)20)16(12)15-11-4-2-3-5-13(11)21-17(15)19/h2-5,12,14,16,21,24H,6-10H2,1H3/t12-,14-,16-,19-,20+/m1/s1 |
| InChIKey | ASELQGFIWGKGJJ-HLNPZMCISA-N |
| XLogP | 1.69 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |