C27H35N3O2 — CID 57343444
methyl (1R,16S,17R,18S,21S)-17,19-dimethyl-18-pyrrolidin-1-yl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,19-pentaene-17-carboxylate (PubChem CID 57343444) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is methyl (1R,16S,17R,18S,21S)-17,19-dimethyl-18-pyrrolidin-1-yl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,19-pentaene-17-carboxylate.
| Compound Name | methyl (1R,16S,17R,18S,21S)-17,19-dimethyl-18-pyrrolidin-1-yl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,19-pentaene-17-carboxylate |
|---|---|
| PubChem CID | 57343444 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | methyl (1R,16S,17R,18S,21S)-17,19-dimethyl-18-pyrrolidin-1-yl-3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-2(10),4,6,8,19-pentaene-17-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@@H](N2CCCC2)C(C)=C[C@@H]2[C@@H]3c4[nH]c5ccccc5c4CCN3CC[C@@H]21 |
| InChI | InChI=1S/C27H35N3O2/c1-17-16-20-21(27(2,26(31)32-3)25(17)30-12-6-7-13-30)11-15-29-14-10-19-18-8-4-5-9-22(18)28-23(19)24(20)29/h4-5,8-9,16,20-21,24-25,28H,6-7,10-15H2,1-3H3/t20-,21-,24+,25-,27+/m0/s1 |
| InChIKey | ZCYMTZPWKSTZDB-UJTAMASSSA-N |
| XLogP | 4.31 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|