C13H19NO3 — CID 177412109
tert-butyl N-but-2-ynyl-N-(2-methylprop-2-enoyl)carbamate (PubChem CID 177412109) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-but-2-ynyl-N-(2-methylprop-2-enoyl)carbamate.
| Compound Name | tert-butyl N-but-2-ynyl-N-(2-methylprop-2-enoyl)carbamate |
|---|---|
| PubChem CID | 177412109 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | tert-butyl N-but-2-ynyl-N-(2-methylprop-2-enoyl)carbamate |
| SMILES | C=C(C)C(=O)N(CC#CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H19NO3/c1-7-8-9-14(11(15)10(2)3)12(16)17-13(4,5)6/h2,9H2,1,3-6H3 |
| InChIKey | NOKIQZVLBSVMKL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|