C17H29NO2 — CID 129187838
tert-butyl N-but-2-ynyl-N-(2,2-dimethylcyclohexyl)carbamate (PubChem CID 129187838) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is tert-butyl N-but-2-ynyl-N-(2,2-dimethylcyclohexyl)carbamate.
| Compound Name | tert-butyl N-but-2-ynyl-N-(2,2-dimethylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 129187838 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | tert-butyl N-but-2-ynyl-N-(2,2-dimethylcyclohexyl)carbamate |
| SMILES | CC#CCN(C(=O)OC(C)(C)C)C1CCCCC1(C)C |
| InChI | InChI=1S/C17H29NO2/c1-7-8-13-18(15(19)20-16(2,3)4)14-11-9-10-12-17(14,5)6/h14H,9-13H2,1-6H3 |
| InChIKey | CUGTXWOFPUAIHF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|