2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid

C12H21NO4 — CID 79852520

IUPAC2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid
SMILESCC1(C)CCCCC1N(CC(=O)O)CC(=O)O
InChIInChI=1S/C12H21NO4/c1-12(2)6-4-3-5-9(12)13(7-10(14)15)8-11(16)17/h9H,3-8H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyXXGZGYKEJIFCAM-UHFFFAOYSA-N
MW243.30 g/mol
LogP1.43
Rot. Bonds5

About 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid

2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid (PubChem CID 79852520) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid.

Molecular Properties

Compound Name2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid
PubChem CID79852520
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Name2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid
SMILESCC1(C)CCCCC1N(CC(=O)O)CC(=O)O
InChIInChI=1S/C12H21NO4/c1-12(2)6-4-3-5-9(12)13(7-10(14)15)8-11(16)17/h9H,3-8H2,1-2H3,(H,14,15)(H,16,17)
InChIKeyXXGZGYKEJIFCAM-UHFFFAOYSA-N
XLogP1.43
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 51.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid?
The IUPAC name of 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid (CID 79852520) is 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid.
What is the SMILES notation for 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid?
The canonical SMILES for 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid is CC1(C)CCCCC1N(CC(=O)O)CC(=O)O.
What is the InChIKey of 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid?
The InChIKey is XXGZGYKEJIFCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO4/c1-12(2)6-4-3-5-9(12)13(7-10(14)15)8-11(16)17/h9H,3-8H2,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid?
2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid has a molecular weight of 243.30 g/mol, XLogP of 1.43, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxymethyl-(2,2-dimethylcyclohexyl)amino]acetic acid is sourced from PubChem (CID 79852520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).