2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid

C13H25NO2 — CID 79852345

IUPAC2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid
SMILESCCC(C(=O)O)N(C)C1CCCCC1(C)C
InChIInChI=1S/C13H25NO2/c1-5-10(12(15)16)14(4)11-8-6-7-9-13(11,2)3/h10-11H,5-9H2,1-4H3,(H,15,16)
InChIKeyNESGJGHGHRVAFB-UHFFFAOYSA-N
MW227.35 g/mol
LogP2.75
Rot. Bonds4

About 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid

2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid (PubChem CID 79852345) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid.

Molecular Properties

Compound Name2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid
PubChem CID79852345
Molecular FormulaC13H25NO2
Molecular Weight227.35 g/mol
Exact Mass227.19
IUPAC Name2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid
SMILESCCC(C(=O)O)N(C)C1CCCCC1(C)C
InChIInChI=1S/C13H25NO2/c1-5-10(12(15)16)14(4)11-8-6-7-9-13(11,2)3/h10-11H,5-9H2,1-4H3,(H,15,16)
InChIKeyNESGJGHGHRVAFB-UHFFFAOYSA-N
XLogP2.75
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.35
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid?
The IUPAC name of 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid (CID 79852345) is 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid.
What is the SMILES notation for 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid?
The canonical SMILES for 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid is CCC(C(=O)O)N(C)C1CCCCC1(C)C.
What is the InChIKey of 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid?
The InChIKey is NESGJGHGHRVAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-5-10(12(15)16)14(4)11-8-6-7-9-13(11,2)3/h10-11H,5-9H2,1-4H3,(H,15,16).
What are the key properties of 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid?
2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid has a molecular weight of 227.35 g/mol, XLogP of 2.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dimethylcyclohexyl)-methylamino]butanoic acid is sourced from PubChem (CID 79852345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).