C13H14O7 — CID 177412715
methyl 5-[(2R)-1-ethoxy-1,4-dioxobutan-2-yl]-6-oxopyran-3-carboxylate (PubChem CID 177412715) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl 5-[(2R)-1-ethoxy-1,4-dioxobutan-2-yl]-6-oxopyran-3-carboxylate.
| Compound Name | methyl 5-[(2R)-1-ethoxy-1,4-dioxobutan-2-yl]-6-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 177412715 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl 5-[(2R)-1-ethoxy-1,4-dioxobutan-2-yl]-6-oxopyran-3-carboxylate |
| SMILES | CCOC(=O)[C@H](CC=O)c1cc(C(=O)OC)coc1=O |
| InChI | InChI=1S/C13H14O7/c1-3-19-12(16)9(4-5-14)10-6-8(11(15)18-2)7-20-13(10)17/h5-7,9H,3-4H2,1-2H3/t9-/m1/s1 |
| InChIKey | GIGTWVOFTFHNDM-SECBINFHSA-N |
| XLogP | 0.66 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|