C10H15NO6 — CID 177415519
methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 177415519) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 177415519 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methyl (3aR,4R,6aS)-4-(acetyloxymethyl)-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | COC(=O)N1C[C@@H]2OCO[C@@H]2[C@H]1COC(C)=O |
| InChI | InChI=1S/C10H15NO6/c1-6(12)15-4-7-9-8(16-5-17-9)3-11(7)10(13)14-2/h7-9H,3-5H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | PXPYEQNFVITWRS-HRDYMLBCSA-N |
| XLogP | -0.26 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |