C26H32O13 — CID 177416474
methyl (4S,5E,6S)-5-(2-benzoyloxyethylidene)-4-(2-methoxy-2-oxoethyl)-4-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyran-3-carboxylate (PubChem CID 177416474) has the molecular formula C26H32O13 and a molecular weight of 552.53 g/mol. Its IUPAC name is methyl (4S,5E,6S)-5-(2-benzoyloxyethylidene)-4-(2-methoxy-2-oxoethyl)-4-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyran-3-carboxylate.
| Compound Name | methyl (4S,5E,6S)-5-(2-benzoyloxyethylidene)-4-(2-methoxy-2-oxoethyl)-4-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyran-3-carboxylate |
|---|---|
| PubChem CID | 177416474 |
| Molecular Formula | C26H32O13 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | methyl (4S,5E,6S)-5-(2-benzoyloxyethylidene)-4-(2-methoxy-2-oxoethyl)-4-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypyran-3-carboxylate |
| SMILES | COC(=O)C[C@]1(C)C(C(=O)OC)=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C1=C/COC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H32O13/c1-26(11-18(28)34-2)15(9-10-36-22(32)14-7-5-4-6-8-14)24(37-13-16(26)23(33)35-3)39-25-21(31)20(30)19(29)17(12-27)38-25/h4-9,13,17,19-21,24-25,27,29-31H,10-12H2,1-3H3/b15-9-/t17-,19-,20+,21-,24+,25+,26+/m1/s1 |
| InChIKey | AXCUHQLASWDMPB-YPYDVCLXSA-N |
| XLogP | -0.43 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|