C24H32O8 — CID 177417195
[(2R,3R,4S,5R,6S)-6-(4-methoxyphenoxy)-4,5-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxan-3-yl] acetate (PubChem CID 177417195) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-(4-methoxyphenoxy)-4,5-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-(4-methoxyphenoxy)-4,5-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 177417195 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-(4-methoxyphenoxy)-4,5-bis(prop-2-enoxy)-2-(prop-2-enoxymethyl)oxan-3-yl] acetate |
| SMILES | C=CCOC[C@H]1O[C@@H](Oc2ccc(OC)cc2)[C@H](OCC=C)[C@@H](OCC=C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H32O8/c1-6-13-27-16-20-21(30-17(4)25)22(28-14-7-2)23(29-15-8-3)24(32-20)31-19-11-9-18(26-5)10-12-19/h6-12,20-24H,1-3,13-16H2,4-5H3/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | IAFVTRMNGXRDJF-GNADVCDUSA-N |
| XLogP | 3.08 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|