C21H26N2O2 — CID 177417774
(2R)-1-(benzhydrylideneamino)oxy-3-piperidin-1-ylpropan-2-ol (PubChem CID 177417774) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is (2R)-1-(benzhydrylideneamino)oxy-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2R)-1-(benzhydrylideneamino)oxy-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 177417774 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2R)-1-(benzhydrylideneamino)oxy-3-piperidin-1-ylpropan-2-ol |
| SMILES | O[C@@H](CON=C(c1ccccc1)c1ccccc1)CN1CCCCC1 |
| InChI | InChI=1S/C21H26N2O2/c24-20(16-23-14-8-3-9-15-23)17-25-22-21(18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,20,24H,3,8-9,14-17H2/t20-/m1/s1 |
| InChIKey | YPSPHQFWQFGUMA-HXUWFJFHSA-N |
| XLogP | 3.30 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|