C15H21N5O9 — CID 177420134
4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methoxypurin-2-yl]oxybutyl nitrate (PubChem CID 177420134) has the molecular formula C15H21N5O9 and a molecular weight of 415.36 g/mol. Its IUPAC name is 4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methoxypurin-2-yl]oxybutyl nitrate.
| Compound Name | 4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methoxypurin-2-yl]oxybutyl nitrate |
|---|---|
| PubChem CID | 177420134 |
| Molecular Formula | C15H21N5O9 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-methoxypurin-2-yl]oxybutyl nitrate |
| SMILES | COc1nc(OCCCCO[N+](=O)[O-])nc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21N5O9/c1-26-13-9-12(17-15(18-13)27-4-2-3-5-28-20(24)25)19(7-16-9)14-11(23)10(22)8(6-21)29-14/h7-8,10-11,14,21-23H,2-6H2,1H3/t8-,10-,11-,14-/m1/s1 |
| InChIKey | VIAWWUDHYMXSPA-IDTAVKCVSA-N |
| XLogP | -1.19 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|