C11H16O5 — CID 177420507
dimethyl (2E,4R,5Z)-4-hydroxy-5-methylocta-2,5-dienedioate (PubChem CID 177420507) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is dimethyl (2E,4R,5Z)-4-hydroxy-5-methylocta-2,5-dienedioate.
| Compound Name | dimethyl (2E,4R,5Z)-4-hydroxy-5-methylocta-2,5-dienedioate |
|---|---|
| PubChem CID | 177420507 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | dimethyl (2E,4R,5Z)-4-hydroxy-5-methylocta-2,5-dienedioate |
| SMILES | COC(=O)/C=C/[C@@H](O)/C(C)=C\CC(=O)OC |
| InChI | InChI=1S/C11H16O5/c1-8(4-6-10(13)15-2)9(12)5-7-11(14)16-3/h4-5,7,9,12H,6H2,1-3H3/b7-5+,8-4-/t9-/m1/s1 |
| InChIKey | FSSHVBCCKUTJRO-LYJYIUSUSA-N |
| XLogP | 0.59 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|