C22H32O8 — CID 177421346
(2R,6S,7S,8Z,10S,11S,15R,17R)-7,10-dihydroxy-4,4,13,13,17,20-hexamethyl-3,5,12,14,21-pentaoxatetracyclo[15.3.1.02,6.011,15]henicosa-1(20),8-dien-16-one (PubChem CID 177421346) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is (2R,6S,7S,8Z,10S,11S,15R,17R)-7,10-dihydroxy-4,4,13,13,17,20-hexamethyl-3,5,12,14,21-pentaoxatetracyclo[15.3.1.02,6.011,15]henicosa-1(20),8-dien-16-one.
| Compound Name | (2R,6S,7S,8Z,10S,11S,15R,17R)-7,10-dihydroxy-4,4,13,13,17,20-hexamethyl-3,5,12,14,21-pentaoxatetracyclo[15.3.1.02,6.011,15]henicosa-1(20),8-dien-16-one |
|---|---|
| PubChem CID | 177421346 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2R,6S,7S,8Z,10S,11S,15R,17R)-7,10-dihydroxy-4,4,13,13,17,20-hexamethyl-3,5,12,14,21-pentaoxatetracyclo[15.3.1.02,6.011,15]henicosa-1(20),8-dien-16-one |
| SMILES | CC1=C2O[C@](C)(CC1)C(=O)[C@@H]1OC(C)(C)O[C@H]1[C@@H](O)/C=C\[C@H](O)[C@@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H32O8/c1-11-9-10-22(6)19(25)18-16(27-21(4,5)29-18)13(24)8-7-12(23)15-17(14(11)30-22)28-20(2,3)26-15/h7-8,12-13,15-18,23-24H,9-10H2,1-6H3/b8-7-/t12-,13-,15-,16-,17-,18+,22+/m0/s1 |
| InChIKey | CFHURRRWRADIDD-MDDPRYKSSA-N |
| XLogP | 1.73 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|