C13H16N2O6S — CID 177421457
methyl (E)-3-[5-(methanesulfonamido)-2-(methoxycarbonylamino)phenyl]prop-2-enoate (PubChem CID 177421457) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is methyl (E)-3-[5-(methanesulfonamido)-2-(methoxycarbonylamino)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-(methanesulfonamido)-2-(methoxycarbonylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 177421457 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | methyl (E)-3-[5-(methanesulfonamido)-2-(methoxycarbonylamino)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(NS(C)(=O)=O)ccc1NC(=O)OC |
| InChI | InChI=1S/C13H16N2O6S/c1-20-12(16)7-4-9-8-10(15-22(3,18)19)5-6-11(9)14-13(17)21-2/h4-8,15H,1-3H3,(H,14,17)/b7-4+ |
| InChIKey | GYTFRKBFEQUBJH-QPJJXVBHSA-N |
| XLogP | 1.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|