C12H23NO3 — CID 177423350
2-[[(E)-2-hydroxyoct-4-enyl]-dimethylazaniumyl]acetate (PubChem CID 177423350) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[[(E)-2-hydroxyoct-4-enyl]-dimethylazaniumyl]acetate.
| Compound Name | 2-[[(E)-2-hydroxyoct-4-enyl]-dimethylazaniumyl]acetate |
|---|---|
| PubChem CID | 177423350 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-[[(E)-2-hydroxyoct-4-enyl]-dimethylazaniumyl]acetate |
| SMILES | CCC/C=C/CC(O)C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C12H23NO3/c1-4-5-6-7-8-11(14)9-13(2,3)10-12(15)16/h6-7,11,14H,4-5,8-10H2,1-3H3/b7-6+ |
| InChIKey | VPUCMRKFUIGRER-VOTSOKGWSA-N |
| XLogP | -0.08 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|