C17H33NO3 — CID 177383924
4-[diethyl-[(E)-2-hydroxyoct-4-enyl]azaniumyl]-2-methylbutanoate (PubChem CID 177383924) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[diethyl-[(E)-2-hydroxyoct-4-enyl]azaniumyl]-2-methylbutanoate.
| Compound Name | 4-[diethyl-[(E)-2-hydroxyoct-4-enyl]azaniumyl]-2-methylbutanoate |
|---|---|
| PubChem CID | 177383924 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 4-[diethyl-[(E)-2-hydroxyoct-4-enyl]azaniumyl]-2-methylbutanoate |
| SMILES | CCC/C=C/CC(O)C[N+](CC)(CC)CCC(C)C(=O)[O-] |
| InChI | InChI=1S/C17H33NO3/c1-5-8-9-10-11-16(19)14-18(6-2,7-3)13-12-15(4)17(20)21/h9-10,15-16,19H,5-8,11-14H2,1-4H3/b10-9+ |
| InChIKey | LLPBGIMHLMEENV-MDZDMXLPSA-N |
| XLogP | 1.73 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|