C19H35Na3O7S — CID 173208090
trisodium;(Z,12R)-12-hydroxy-2-methyloctadec-9-enoate;sulfate (PubChem CID 173208090) has the molecular formula C19H35Na3O7S and a molecular weight of 476.52 g/mol. Its IUPAC name is trisodium;(Z,12R)-12-hydroxy-2-methyloctadec-9-enoate;sulfate.
| Compound Name | trisodium;(Z,12R)-12-hydroxy-2-methyloctadec-9-enoate;sulfate |
|---|---|
| PubChem CID | 173208090 |
| Molecular Formula | C19H35Na3O7S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | trisodium;(Z,12R)-12-hydroxy-2-methyloctadec-9-enoate;sulfate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC(C)C(=O)[O-].O=S(=O)([O-])[O-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C19H36O3.3Na.H2O4S/c1-3-4-5-12-15-18(20)16-13-10-8-6-7-9-11-14-17(2)19(21)22;;;;1-5(2,3)4/h10,13,17-18,20H,3-9,11-12,14-16H2,1-2H3,(H,21,22);;;;(H2,1,2,3,4)/q;3*+1;/p-3/b13-10-;;;;/t17?,18-;;;;/m1..../s1 |
| InChIKey | OBQIMXQWWVGPRX-BFDSQITRSA-K |
| XLogP | -6.34 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | -6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|