C19H27N2- — CID 177423880
cyclohexyl-[(Z)-[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]azanide (PubChem CID 177423880) has the molecular formula C19H27N2- and a molecular weight of 283.44 g/mol. Its IUPAC name is cyclohexyl-[(Z)-[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]azanide.
| Compound Name | cyclohexyl-[(Z)-[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]azanide |
|---|---|
| PubChem CID | 177423880 |
| Molecular Formula | C19H27N2- |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.22 |
| IUPAC Name | cyclohexyl-[(Z)-[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]azanide |
| SMILES | C1=C/C(=C/[N-]C2CCCCC2)C(/C=N/C2CCCCC2)=C1 |
| InChI | InChI=1S/C19H27N2/c1-3-10-18(11-4-1)20-14-16-8-7-9-17(16)15-21-19-12-5-2-6-13-19/h7-9,14-15,18-19H,1-6,10-13H2/q-1/b16-14-,21-15+ |
| InChIKey | IHOUGJCANIFFKZ-BAXAEGEVSA-N |
| XLogP | 5.48 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|