C19H28N2 — CID 5250525
N-[[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]cyclohexanamine (PubChem CID 5250525) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is N-[[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]cyclohexanamine.
| Compound Name | N-[[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]cyclohexanamine |
|---|---|
| PubChem CID | 5250525 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | N-[[2-(cyclohexyliminomethyl)cyclopenta-2,4-dien-1-ylidene]methyl]cyclohexanamine |
| SMILES | C1=CC(=CNC2CCCCC2)C(/C=N/C2CCCCC2)=C1 |
| InChI | InChI=1S/C19H28N2/c1-3-10-18(11-4-1)20-14-16-8-7-9-17(16)15-21-19-12-5-2-6-13-19/h7-9,14-15,18-20H,1-6,10-13H2/b16-14?,21-15+ |
| InChIKey | IQACXDMWLKWVJO-WMWAGOIRSA-N |
| XLogP | 4.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|