C16H24N2 — CID 153390167
(E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine;ethane (PubChem CID 153390167) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine;ethane.
| Compound Name | (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine;ethane |
|---|---|
| PubChem CID | 153390167 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine;ethane |
| SMILES | C/N=C/C(C)=C(\C)C1=CNC2CC=CC=C12.CC |
| InChI | InChI=1S/C14H18N2.C2H6/c1-10(8-15-3)11(2)13-9-16-14-7-5-4-6-12(13)14;1-2/h4-6,8-9,14,16H,7H2,1-3H3;1-2H3/b11-10+,15-8+; |
| InChIKey | WQYLPHIXUAJMHD-IBZBWWJTSA-N |
| XLogP | 3.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|