About lithium 1-phenylpyrrolidine
lithium 1-phenylpyrrolidine (PubChem CID 177424093) has the molecular formula C10H12LiN
and a molecular weight of 153.15 g/mol. Its IUPAC name is lithium 1-phenylpyrrolidine.
Molecular Properties
| Compound Name | lithium 1-phenylpyrrolidine |
| PubChem CID | 177424093 |
| Molecular Formula | C10H12LiN |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.11 |
| IUPAC Name | lithium 1-phenylpyrrolidine |
| SMILES | [Li+].[c-]1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C10H12N.Li/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h2-3,6-7H,4-5,8-9H2;/q-1;+1 |
| InChIKey | IDOFWGQMOHPRQS-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 1-phenylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 1-phenylpyrrolidine?
The IUPAC name of lithium 1-phenylpyrrolidine (CID 177424093) is lithium 1-phenylpyrrolidine.
What is the SMILES notation for lithium 1-phenylpyrrolidine?
The canonical SMILES for lithium 1-phenylpyrrolidine is [Li+].[c-]1ccc(N2CCCC2)cc1.
What is the InChIKey of lithium 1-phenylpyrrolidine?
The InChIKey is IDOFWGQMOHPRQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N.Li/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h2-3,6-7H,4-5,8-9H2;/q-1;+1.
What are the key properties of lithium 1-phenylpyrrolidine?
lithium 1-phenylpyrrolidine has a molecular weight of 153.15 g/mol, XLogP of -0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 1-phenylpyrrolidine is sourced from PubChem (CID 177424093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).