C10H13N — CID 175933366
1-(3,5-dideuteriophenyl)pyrrolidine (PubChem CID 175933366) has the molecular formula C10H13N and a molecular weight of 149.23 g/mol. Its IUPAC name is 1-(3,5-dideuteriophenyl)pyrrolidine.
| Compound Name | 1-(3,5-dideuteriophenyl)pyrrolidine |
|---|---|
| PubChem CID | 175933366 |
| Molecular Formula | C10H13N |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-(3,5-dideuteriophenyl)pyrrolidine |
| SMILES | [2H]c1cc([2H])cc(N2CCCC2)c1 |
| InChI | InChI=1S/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2/i2D,3D |
| InChIKey | VDQQJMHXZCMNMU-PBNXXWCMSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |