C39H45N4O3+ — CID 177427271
1,3-dimethyl-5-[(7E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-7-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohepten-1-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 177427271) has the molecular formula C39H45N4O3+ and a molecular weight of 617.81 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(7E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-7-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohepten-1-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(7E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-7-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohepten-1-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 177427271 |
| Molecular Formula | C39H45N4O3+ |
| Molecular Weight | 617.81 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | 1,3-dimethyl-5-[(7E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-7-[(2Z)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohepten-1-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(C2=C(/C=C/C3=[N+](C)c4ccccc4C3(C)C)CCCC/C2=C\C=C2/N(C)c3ccccc3C2(C)C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C39H45N4O3/c1-38(2)27-17-11-13-19-29(27)40(5)31(38)23-21-25-15-9-10-16-26(33(25)34-35(44)42(7)37(46)43(8)36(34)45)22-24-32-39(3,4)28-18-12-14-20-30(28)41(32)6/h11-14,17-24,34H,9-10,15-16H2,1-8H3/q+1 |
| InChIKey | UFPBFIABSCVRFR-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 63.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.81 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|