C38H53N4O+ — CID 171843339
methoxymethane;N'-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]butane-1,4-diamine (PubChem CID 171843339) has the molecular formula C38H53N4O+ and a molecular weight of 581.87 g/mol. Its IUPAC name is methoxymethane;N'-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]butane-1,4-diamine.
| Compound Name | methoxymethane;N'-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171843339 |
| Molecular Formula | C38H53N4O+ |
| Molecular Weight | 581.87 g/mol |
| Exact Mass | 581.42 |
| IUPAC Name | methoxymethane;N'-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]butane-1,4-diamine |
| SMILES | CN1/C(=C/C=C2\CCCC(/C=C/C3=[N+](C)c4ccccc4C3(C)C)=C2NCCCCN)C(C)(C)c2ccccc21.COC |
| InChI | InChI=1S/C36H46N4.C2H6O/c1-35(2)28-16-7-9-18-30(28)39(5)32(35)22-20-26-14-13-15-27(34(26)38-25-12-11-24-37)21-23-33-36(3,4)29-17-8-10-19-31(29)40(33)6;1-3-2/h7-10,16-23H,11-15,24-25,37H2,1-6H3;1-2H3/p+1/b26-20+,32-22+; |
| InChIKey | ZIUZSVZSLDDEDO-FAKWAEIUSA-O |
| XLogP | 7.52 |
| TPSA | 53.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.87 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|