C39H51N4+ — CID 145469967
1-N-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]hept-6-ene-1,6-diamine (PubChem CID 145469967) has the molecular formula C39H51N4+ and a molecular weight of 575.87 g/mol. Its IUPAC name is 1-N-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]hept-6-ene-1,6-diamine.
| Compound Name | 1-N-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]hept-6-ene-1,6-diamine |
|---|---|
| PubChem CID | 145469967 |
| Molecular Formula | C39H51N4+ |
| Molecular Weight | 575.87 g/mol |
| Exact Mass | 575.41 |
| IUPAC Name | 1-N-[(6E)-2-[(E)-2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[(2E)-2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]hept-6-ene-1,6-diamine |
| SMILES | C=C(N)CCCCCNC1=C(/C=C/C2=[N+](C)c3ccccc3C2(C)C)CCC/C1=C\C=C1\N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C39H50N4/c1-28(40)16-9-8-14-27-41-37-29(23-25-35-38(2,3)31-19-10-12-21-33(31)42(35)6)17-15-18-30(37)24-26-36-39(4,5)32-20-11-13-22-34(32)43(36)7/h10-13,19-26H,1,8-9,14-18,27,40H2,2-7H3/p+1/b29-23+,35-25+ |
| InChIKey | IUJNVXFJKASSHG-CQGHKKSHSA-O |
| XLogP | 8.55 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.87 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|