C43H45N4S3+ — CID 123152562
2-[(4-ethenylphenyl)methylsulfanyl]-5-[2-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanyl-1,3,4-thiadiazole (PubChem CID 123152562) has the molecular formula C43H45N4S3+ and a molecular weight of 714.06 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methylsulfanyl]-5-[2-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanyl-1,3,4-thiadiazole.
| Compound Name | 2-[(4-ethenylphenyl)methylsulfanyl]-5-[2-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 123152562 |
| Molecular Formula | C43H45N4S3+ |
| Molecular Weight | 714.06 g/mol |
| Exact Mass | 713.28 |
| IUPAC Name | 2-[(4-ethenylphenyl)methylsulfanyl]-5-[2-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-6-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]sulfanyl-1,3,4-thiadiazole |
| SMILES | C=Cc1ccc(CSc2nnc(SC3=C(C=CC4=[N+](C)c5ccccc5C4(C)C)CCCC3=CC=C3N(C)c4ccccc4C3(C)C)s2)cc1 |
| InChI | InChI=1S/C43H45N4S3/c1-8-29-20-22-30(23-21-29)28-48-40-44-45-41(50-40)49-39-31(24-26-37-42(2,3)33-16-9-11-18-35(33)46(37)6)14-13-15-32(39)25-27-38-43(4,5)34-17-10-12-19-36(34)47(38)7/h8-12,16-27H,1,13-15,28H2,2-7H3/q+1 |
| InChIKey | MAUQSLQBXVAPPU-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 32.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.06 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|