C41H51N2O3S+ — CID 91870205
1,3,3-trimethyl-2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylsulfanyl]-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole (PubChem CID 91870205) has the molecular formula C41H51N2O3S+ and a molecular weight of 651.94 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylsulfanyl]-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylsulfanyl]-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
|---|---|
| PubChem CID | 91870205 |
| Molecular Formula | C41H51N2O3S+ |
| Molecular Weight | 651.94 g/mol |
| Exact Mass | 651.36 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethylsulfanyl]-3-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]indole |
| SMILES | C#CCOCCOCCOCCSC1=C(C=CC2=[N+](C)c3ccccc3C2(C)C)CCCC1=CC=C1N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C41H51N2O3S/c1-8-24-44-25-26-45-27-28-46-29-30-47-39-31(20-22-37-40(2,3)33-16-9-11-18-35(33)42(37)6)14-13-15-32(39)21-23-38-41(4,5)34-17-10-12-19-36(34)43(38)7/h1,9-12,16-23H,13-15,24-30H2,2-7H3/q+1 |
| InChIKey | KNDNFLSRSAOPSR-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 33.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.94 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|